C7H13NO — CID 175988145
(4S)-3,5-dimethyl-2,3,4,5-tetrahydropyridin-4-ol (PubChem CID 175988145) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (4S)-3,5-dimethyl-2,3,4,5-tetrahydropyridin-4-ol.
| Compound Name | (4S)-3,5-dimethyl-2,3,4,5-tetrahydropyridin-4-ol |
|---|---|
| PubChem CID | 175988145 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (4S)-3,5-dimethyl-2,3,4,5-tetrahydropyridin-4-ol |
| SMILES | CC1C=NCC(C)[C@@H]1O |
| InChI | InChI=1S/C7H13NO/c1-5-3-8-4-6(2)7(5)9/h3,5-7,9H,4H2,1-2H3/t5?,6?,7-/m1/s1 |
| InChIKey | POMZPOULYMUFFO-KPGICGJXSA-N |
| XLogP | 0.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |