C11H21FN2O — CID 175988469
(3R,4S)-3-fluoro-4-methoxy-1-piperidin-4-ylpiperidine (PubChem CID 175988469) has the molecular formula C11H21FN2O and a molecular weight of 216.30 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-4-methoxy-1-piperidin-4-ylpiperidine.
| Compound Name | (3R,4S)-3-fluoro-4-methoxy-1-piperidin-4-ylpiperidine |
|---|---|
| PubChem CID | 175988469 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (3R,4S)-3-fluoro-4-methoxy-1-piperidin-4-ylpiperidine |
| SMILES | CO[C@H]1CCN(C2CCNCC2)C[C@H]1F |
| InChI | InChI=1S/C11H21FN2O/c1-15-11-4-7-14(8-10(11)12)9-2-5-13-6-3-9/h9-11,13H,2-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | LLTFJCALJQACAB-MNOVXSKESA-N |
| XLogP | 0.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |