About 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde
6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde (PubChem CID 175988838) has the molecular formula C21H15N3O3
and a molecular weight of 357.37 g/mol. Its IUPAC name is 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde.
Molecular Properties
| Compound Name | 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde |
| PubChem CID | 175988838 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde |
| SMILES | O=Cc1ncc2c(n1)N(c1ccc(Oc3ccccc3)cc1)C(=O)C21CC1 |
| InChI | InChI=1S/C21H15N3O3/c25-13-18-22-12-17-19(23-18)24(20(26)21(17)10-11-21)14-6-8-16(9-7-14)27-15-4-2-1-3-5-15/h1-9,12-13H,10-11H2 |
| InChIKey | VNAHAPJMRXCSMJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde?
The IUPAC name of 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde (CID 175988838) is 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde.
What is the SMILES notation for 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde?
The canonical SMILES for 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde is O=Cc1ncc2c(n1)N(c1ccc(Oc3ccccc3)cc1)C(=O)C21CC1.
What is the InChIKey of 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde?
The InChIKey is VNAHAPJMRXCSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O3/c25-13-18-22-12-17-19(23-18)24(20(26)21(17)10-11-21)14-6-8-16(9-7-14)27-15-4-2-1-3-5-15/h1-9,12-13H,10-11H2.
What are the key properties of 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde?
6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde has a molecular weight of 357.37 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-oxo-7'-(4-phenoxyphenyl)spiro[cyclopropane-1,5'-pyrrolo[2,3-d]pyrimidine]-2'-carbaldehyde is sourced from PubChem (CID 175988838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).