C26H3BF20O2Pd — CID 175989138
palladium(2+);tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;acetate (PubChem CID 175989138) has the molecular formula C26H3BF20O2Pd and a molecular weight of 844.50 g/mol. Its IUPAC name is palladium(2+);tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;acetate.
| Compound Name | palladium(2+);tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;acetate |
|---|---|
| PubChem CID | 175989138 |
| Molecular Formula | C26H3BF20O2Pd |
| Molecular Weight | 844.50 g/mol |
| Exact Mass | 843.89 |
| IUPAC Name | palladium(2+);tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;acetate |
| SMILES | CC(=O)[O-].Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[Pd+2] |
| InChI | InChI=1S/C24BF20.C2H4O2.Pd/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-2(3)4;/h;1H3,(H,3,4);/q-1;;+2/p-1 |
| InChIKey | VMXOGMZDTBROFR-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|