C17H14O5S — CID 175989189
(E)-but-2-enedioic acid;6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (PubChem CID 175989189) has the molecular formula C17H14O5S and a molecular weight of 330.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one.
| Compound Name | (E)-but-2-enedioic acid;6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 175989189 |
| Molecular Formula | C17H14O5S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (E)-but-2-enedioic acid;6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1Cc2ccccc2Cc2ccsc21 |
| InChI | InChI=1S/C13H10OS.C4H4O4/c14-12-8-10-4-2-1-3-9(10)7-11-5-6-15-13(11)12;5-3(6)1-2-4(7)8/h1-6H,7-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PIIGZNXHLCNOBS-WLHGVMLRSA-N |
| XLogP | 2.79 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|