C12H22N4S — CID 175991493
N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 175991493) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 175991493 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CN1C(C)(C)CC(Nc2nncs2)CC1(C)C |
| InChI | InChI=1S/C12H22N4S/c1-11(2)6-9(7-12(3,4)16(11)5)14-10-15-13-8-17-10/h8-9H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | FSPMOYGETRSVQV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |