C22H34BClO4Si — CID 175991597
5-[2-chloro-4-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-1-ynyl-trimethylsilane (PubChem CID 175991597) has the molecular formula C22H34BClO4Si and a molecular weight of 436.86 g/mol. Its IUPAC name is 5-[2-chloro-4-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-1-ynyl-trimethylsilane.
| Compound Name | 5-[2-chloro-4-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 175991597 |
| Molecular Formula | C22H34BClO4Si |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 5-[2-chloro-4-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pent-1-ynyl-trimethylsilane |
| SMILES | COCOc1cc(Cl)c(CCCC#C[Si](C)(C)C)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H34BClO4Si/c1-21(2)22(3,4)28-23(27-21)19-14-17(26-16-25-5)15-20(24)18(19)12-10-9-11-13-29(6,7)8/h14-15H,9-10,12,16H2,1-8H3 |
| InChIKey | IBPVCDCKUDMEEU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|