(2S)-2-aminopentanoyl fluoride

C5H10FNO — CID 175991681

IUPAC(2S)-2-aminopentanoyl fluoride
SMILESCCC[C@H](N)C(=O)F
InChIInChI=1S/C5H10FNO/c1-2-3-4(7)5(6)8/h4H,2-3,7H2,1H3/t4-/m0/s1
InChIKeyFNQIPDPMYWFAGR-BYPYZUCNSA-N
MW119.14 g/mol
LogP0.61
Rot. Bonds3

About (2S)-2-aminopentanoyl fluoride

(2S)-2-aminopentanoyl fluoride (PubChem CID 175991681) has the molecular formula C5H10FNO and a molecular weight of 119.14 g/mol. Its IUPAC name is (2S)-2-aminopentanoyl fluoride.

Molecular Properties

Compound Name(2S)-2-aminopentanoyl fluoride
PubChem CID175991681
Molecular FormulaC5H10FNO
Molecular Weight119.14 g/mol
Exact Mass119.07
IUPAC Name(2S)-2-aminopentanoyl fluoride
SMILESCCC[C@H](N)C(=O)F
InChIInChI=1S/C5H10FNO/c1-2-3-4(7)5(6)8/h4H,2-3,7H2,1H3/t4-/m0/s1
InChIKeyFNQIPDPMYWFAGR-BYPYZUCNSA-N
XLogP0.61
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500119.14
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (2S)-2-aminopentanoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-aminopentanoyl fluoride?
The IUPAC name of (2S)-2-aminopentanoyl fluoride (CID 175991681) is (2S)-2-aminopentanoyl fluoride.
What is the SMILES notation for (2S)-2-aminopentanoyl fluoride?
The canonical SMILES for (2S)-2-aminopentanoyl fluoride is CCC[C@H](N)C(=O)F.
What is the InChIKey of (2S)-2-aminopentanoyl fluoride?
The InChIKey is FNQIPDPMYWFAGR-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H10FNO/c1-2-3-4(7)5(6)8/h4H,2-3,7H2,1H3/t4-/m0/s1.
What are the key properties of (2S)-2-aminopentanoyl fluoride?
(2S)-2-aminopentanoyl fluoride has a molecular weight of 119.14 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanoyl fluoride is sourced from PubChem (CID 175991681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).