C37H40FN11O3 — CID 175992332
3-[4-[3-[4-[4-[6-amino-5-[(1S)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]azetidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 175992332) has the molecular formula C37H40FN11O3 and a molecular weight of 705.80 g/mol. Its IUPAC name is 3-[4-[3-[4-[4-[6-amino-5-[(1S)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]azetidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[3-[4-[4-[6-amino-5-[(1S)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]azetidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175992332 |
| Molecular Formula | C37H40FN11O3 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.33 |
| IUPAC Name | 3-[4-[3-[4-[4-[6-amino-5-[(1S)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]azetidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | C[C@H](Oc1cc(-c2cnn(C3CCN(C4CN(c5ccc(NC6CCC(=O)NC6=O)cc5)C4)CC3)c2)cnc1N)c1cc(F)ccc1-n1nccn1 |
| InChI | InChI=1S/C37H40FN11O3/c1-23(31-17-26(38)2-8-33(31)49-41-12-13-42-49)52-34-16-24(18-40-36(34)39)25-19-43-48(20-25)29-10-14-46(15-11-29)30-21-47(22-30)28-5-3-27(4-6-28)44-32-7-9-35(50)45-37(32)51/h2-6,8,12-13,16-20,23,29-30,32,44H,7,9-11,14-15,21-22H2,1H3,(H2,39,40)(H,45,50,51)/t23-,32?/m0/s1 |
| InChIKey | FPSREOGDNAMOTF-SZGIACGNSA-N |
| XLogP | 4.13 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|