About 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid
1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 175993030) has the molecular formula C4H5N3O2
and a molecular weight of 130.12 g/mol. Its IUPAC name is 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 175993030 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | [2H]C([2H])([2H])n1cnc(C(=O)O)n1 |
| InChI | InChI=1S/C4H5N3O2/c1-7-2-5-3(6-7)4(8)9/h2H,1H3,(H,8,9)/i1D3 |
| InChIKey | PMEKKJJZHNQEIZ-FIBGUPNXSA-N |
| XLogP | -0.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid (CID 175993030) is 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid is [2H]C([2H])([2H])n1cnc(C(=O)O)n1.
What is the InChIKey of 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid?
The InChIKey is PMEKKJJZHNQEIZ-FIBGUPNXSA-N. The full InChI is InChI=1S/C4H5N3O2/c1-7-2-5-3(6-7)4(8)9/h2H,1H3,(H,8,9)/i1D3.
What are the key properties of 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid?
1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid has a molecular weight of 130.12 g/mol, XLogP of -0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trideuteriomethyl)-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 175993030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).