About 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide
4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 175993237) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| PubChem CID | 175993237 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | CC1CCN(C(N)=O)C(c2nccs2)C1 |
| InChI | InChI=1S/C10H15N3OS/c1-7-2-4-13(10(11)14)8(6-7)9-12-3-5-15-9/h3,5,7-8H,2,4,6H2,1H3,(H2,11,14) |
| InChIKey | JNZZLGADYNMAKK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide?
The IUPAC name of 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide (CID 175993237) is 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
What is the SMILES notation for 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide?
The canonical SMILES for 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide is CC1CCN(C(N)=O)C(c2nccs2)C1.
What is the InChIKey of 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide?
The InChIKey is JNZZLGADYNMAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS/c1-7-2-4-13(10(11)14)8(6-7)9-12-3-5-15-9/h3,5,7-8H,2,4,6H2,1H3,(H2,11,14).
What are the key properties of 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide?
4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide has a molecular weight of 225.32 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide is sourced from PubChem (CID 175993237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).