C33H52N2O3 — CID 175993884
N-(2-aminoethyl)-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanamide (PubChem CID 175993884) has the molecular formula C33H52N2O3 and a molecular weight of 524.79 g/mol. Its IUPAC name is N-(2-aminoethyl)-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanamide.
| Compound Name | N-(2-aminoethyl)-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 175993884 |
| Molecular Formula | C33H52N2O3 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | N-(2-aminoethyl)-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanamide |
| SMILES | CC(C)(C)c1cc(C(CC(=O)NCCN)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H52N2O3/c1-30(2,3)23-15-20(16-24(28(23)37)31(4,5)6)22(19-27(36)35-14-13-34)21-17-25(32(7,8)9)29(38)26(18-21)33(10,11)12/h15-18,22,37-38H,13-14,19,34H2,1-12H3,(H,35,36) |
| InChIKey | RAEBTXRTXNSZQA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |