About 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine
3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 175994160) has the molecular formula C7H5FN2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 175994160 |
| Molecular Formula | C7H5FN2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | [2H]c1c[nH]c2ncc(F)cc12 |
| InChI | InChI=1S/C7H5FN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)/i1D |
| InChIKey | BALBNSFYMXBWNM-MICDWDOJSA-N |
| XLogP | 1.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine (CID 175994160) is 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine is [2H]c1c[nH]c2ncc(F)cc12.
What is the InChIKey of 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is BALBNSFYMXBWNM-MICDWDOJSA-N. The full InChI is InChI=1S/C7H5FN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)/i1D.
What are the key properties of 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine?
3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 137.14 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-deuterio-5-fluoro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 175994160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).