C20H23N5O4S2 — CID 175994523
1-[amino-[2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 175994523) has the molecular formula C20H23N5O4S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-[amino-[2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 175994523 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-[amino-[2-[(2S)-1,2-dihydroxypropan-2-yl]-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(8-cyano-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | C[C@](O)(CO)c1ncc(S(N)(=O)=NC(=O)Nc2c3c(c(C#N)c4c2CCC4)CCC3)s1 |
| InChI | InChI=1S/C20H23N5O4S2/c1-20(28,10-26)18-23-9-16(30-18)31(22,29)25-19(27)24-17-13-6-2-4-11(13)15(8-21)12-5-3-7-14(12)17/h9,26,28H,2-7,10H2,1H3,(H3,22,24,25,27,29)/t20-,31?/m0/s1 |
| InChIKey | SHCHLDNWQYITPA-MFYZJFEASA-N |
| XLogP | 2.12 |
| TPSA | 161.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |