C14H12O6 — CID 175994525
1,8-dioxacyclotetradeca-2,4,6,9,11,13-hexaene-3,12-dicarboxylic acid (PubChem CID 175994525) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is 1,8-dioxacyclotetradeca-2,4,6,9,11,13-hexaene-3,12-dicarboxylic acid.
| Compound Name | 1,8-dioxacyclotetradeca-2,4,6,9,11,13-hexaene-3,12-dicarboxylic acid |
|---|---|
| PubChem CID | 175994525 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1,8-dioxacyclotetradeca-2,4,6,9,11,13-hexaene-3,12-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=COC=CC=CC(C(=O)O)=COC=C1 |
| InChI | InChI=1S/C14H12O6/c15-13(16)11-5-3-8-19-7-2-1-4-12(14(17)18)10-20-9-6-11/h1-10H,(H,15,16)(H,17,18) |
| InChIKey | OBFZITPBYVLNER-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |