C23H28N6O2 — CID 175995322
4-[4-[[4-[(5-cyano-2-pyridinyl)amino]cyclohexyl]amino]phenyl]piperazine-1-carboxylic acid (PubChem CID 175995322) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-[4-[[4-[(5-cyano-2-pyridinyl)amino]cyclohexyl]amino]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-[[4-[(5-cyano-2-pyridinyl)amino]cyclohexyl]amino]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175995322 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4-[4-[[4-[(5-cyano-2-pyridinyl)amino]cyclohexyl]amino]phenyl]piperazine-1-carboxylic acid |
| SMILES | N#Cc1ccc(NC2CCC(Nc3ccc(N4CCN(C(=O)O)CC4)cc3)CC2)nc1 |
| InChI | InChI=1S/C23H28N6O2/c24-15-17-1-10-22(25-16-17)27-20-4-2-18(3-5-20)26-19-6-8-21(9-7-19)28-11-13-29(14-12-28)23(30)31/h1,6-10,16,18,20,26H,2-5,11-14H2,(H,25,27)(H,30,31) |
| InChIKey | MLAIMEOEHZUGLS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|