C26H37N5O4 — CID 175995483
3-[7-[(4-aminocyclohexyl)-(3-morpholin-4-ylpropyl)amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175995483) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[7-[(4-aminocyclohexyl)-(3-morpholin-4-ylpropyl)amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(4-aminocyclohexyl)-(3-morpholin-4-ylpropyl)amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175995483 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 3-[7-[(4-aminocyclohexyl)-(3-morpholin-4-ylpropyl)amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC1CCC(N(CCCN2CCOCC2)c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C26H37N5O4/c27-18-5-7-19(8-6-18)30(12-2-11-29-13-15-35-16-14-29)22-4-1-3-20-21(22)17-31(26(20)34)23-9-10-24(32)28-25(23)33/h1,3-4,18-19,23H,2,5-17,27H2,(H,28,32,33) |
| InChIKey | VXEIMMYABYMIEX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|