About 1,3-dimethylbenzene-2-ide;iron
1,3-dimethylbenzene-2-ide;iron (PubChem CID 175995533) has the molecular formula C8H9Fe-
and a molecular weight of 161.00 g/mol. Its IUPAC name is 1,3-dimethylbenzene-2-ide;iron.
Molecular Properties
| Compound Name | 1,3-dimethylbenzene-2-ide;iron |
| PubChem CID | 175995533 |
| Molecular Formula | C8H9Fe- |
| Molecular Weight | 161.00 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 1,3-dimethylbenzene-2-ide;iron |
| SMILES | Cc1[c-]c(C)ccc1.[Fe] |
| InChI | InChI=1S/C8H9.Fe/c1-7-4-3-5-8(2)6-7;/h3-5H,1-2H3;/q-1; |
| InChIKey | OIDSIBOPPMTZPI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.00 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylbenzene-2-ide;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylbenzene-2-ide;iron?
The IUPAC name of 1,3-dimethylbenzene-2-ide;iron (CID 175995533) is 1,3-dimethylbenzene-2-ide;iron.
What is the SMILES notation for 1,3-dimethylbenzene-2-ide;iron?
The canonical SMILES for 1,3-dimethylbenzene-2-ide;iron is Cc1[c-]c(C)ccc1.[Fe].
What is the InChIKey of 1,3-dimethylbenzene-2-ide;iron?
The InChIKey is OIDSIBOPPMTZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9.Fe/c1-7-4-3-5-8(2)6-7;/h3-5H,1-2H3;/q-1;.
What are the key properties of 1,3-dimethylbenzene-2-ide;iron?
1,3-dimethylbenzene-2-ide;iron has a molecular weight of 161.00 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylbenzene-2-ide;iron is sourced from PubChem (CID 175995533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).