About [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone
[4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 175995971) has the molecular formula C22H15FN2O2
and a molecular weight of 358.37 g/mol. Its IUPAC name is [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone |
| PubChem CID | 175995971 |
| Molecular Formula | C22H15FN2O2 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCc2c(-c3cc4ccccc4o3)cncc21 |
| InChI | InChI=1S/C22H15FN2O2/c23-18-7-3-2-6-16(18)22(26)25-10-9-15-17(12-24-13-19(15)25)21-11-14-5-1-4-8-20(14)27-21/h1-8,11-13H,9-10H2 |
| InChIKey | ZJQQAGZIEXYKQI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone?
The IUPAC name of [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone (CID 175995971) is [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone.
What is the SMILES notation for [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone?
The canonical SMILES for [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone is O=C(c1ccccc1F)N1CCc2c(-c3cc4ccccc4o3)cncc21.
What is the InChIKey of [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone?
The InChIKey is ZJQQAGZIEXYKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15FN2O2/c23-18-7-3-2-6-16(18)22(26)25-10-9-15-17(12-24-13-19(15)25)21-11-14-5-1-4-8-20(14)27-21/h1-8,11-13H,9-10H2.
What are the key properties of [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone?
[4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone has a molecular weight of 358.37 g/mol, XLogP of 4.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-benzofuran-2-yl)-2,3-dihydropyrrolo[2,3-c]pyridin-1-yl]-(2-fluorophenyl)methanone is sourced from PubChem (CID 175995971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).