C18H24Cl2F2N4 — CID 175996161
(3aR,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;dihydrochloride (PubChem CID 175996161) has the molecular formula C18H24Cl2F2N4 and a molecular weight of 405.32 g/mol. Its IUPAC name is (3aR,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;dihydrochloride.
| Compound Name | (3aR,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 175996161 |
| Molecular Formula | C18H24Cl2F2N4 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (3aR,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-amine;dihydrochloride |
| SMILES | Cc1nn(C)cc1-c1ccc(NC2C[C@H]3CNC[C@H]3C2)c(F)c1F.Cl.Cl |
| InChI | InChI=1S/C18H22F2N4.2ClH/c1-10-15(9-24(2)23-10)14-3-4-16(18(20)17(14)19)22-13-5-11-7-21-8-12(11)6-13;;/h3-4,9,11-13,21-22H,5-8H2,1-2H3;2*1H/t11-,12+,13?;; |
| InChIKey | QRTJIUQZCUHQMA-NUSLWUIESA-N |
| XLogP | 3.93 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |