About 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol
2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol (PubChem CID 175996715) has the molecular formula C23H32O5Si
and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol.
Molecular Properties
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol |
| PubChem CID | 175996715 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCOC1(c2ccccc2)Oc2ccccc2C(O)C1O |
| InChI | InChI=1S/C23H32O5Si/c1-22(2,3)29(4,5)27-16-15-26-23(17-11-7-6-8-12-17)21(25)20(24)18-13-9-10-14-19(18)28-23/h6-14,20-21,24-25H,15-16H2,1-5H3 |
| InChIKey | CTMYDWBJTQNMGQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol?
The IUPAC name of 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol (CID 175996715) is 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol.
What is the SMILES notation for 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol?
The canonical SMILES for 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol is CC(C)(C)[Si](C)(C)OCCOC1(c2ccccc2)Oc2ccccc2C(O)C1O.
What is the InChIKey of 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol?
The InChIKey is CTMYDWBJTQNMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32O5Si/c1-22(2,3)29(4,5)27-16-15-26-23(17-11-7-6-8-12-17)21(25)20(24)18-13-9-10-14-19(18)28-23/h6-14,20-21,24-25H,15-16H2,1-5H3.
What are the key properties of 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol?
2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol has a molecular weight of 416.59 g/mol, XLogP of 4.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenyl-3,4-dihydrochromene-3,4-diol is sourced from PubChem (CID 175996715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).