C10H13F3N6 — CID 175997380
2-N-(1,1,1-trifluoropentan-2-yl)imidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 175997380) has the molecular formula C10H13F3N6 and a molecular weight of 274.25 g/mol. Its IUPAC name is 2-N-(1,1,1-trifluoropentan-2-yl)imidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-(1,1,1-trifluoropentan-2-yl)imidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 175997380 |
| Molecular Formula | C10H13F3N6 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-N-(1,1,1-trifluoropentan-2-yl)imidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCCC(Nc1nc(N)c2nccn2n1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N6/c1-2-3-6(10(11,12)13)16-9-17-7(14)8-15-4-5-19(8)18-9/h4-6H,2-3H2,1H3,(H3,14,16,17,18) |
| InChIKey | WLOBUAHMMZBFTP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|