C18H14F3NO5S — CID 175997788
[2-amino-5-deuterio-4-oxo-5-[3-(trifluoromethyl)phenyl]furan-3-yl] phenylmethanesulfonate (PubChem CID 175997788) has the molecular formula C18H14F3NO5S and a molecular weight of 414.38 g/mol. Its IUPAC name is [2-amino-5-deuterio-4-oxo-5-[3-(trifluoromethyl)phenyl]furan-3-yl] phenylmethanesulfonate.
| Compound Name | [2-amino-5-deuterio-4-oxo-5-[3-(trifluoromethyl)phenyl]furan-3-yl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 175997788 |
| Molecular Formula | C18H14F3NO5S |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [2-amino-5-deuterio-4-oxo-5-[3-(trifluoromethyl)phenyl]furan-3-yl] phenylmethanesulfonate |
| SMILES | [2H]C1(c2cccc(C(F)(F)F)c2)OC(N)=C(OS(=O)(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H14F3NO5S/c19-18(20,21)13-8-4-7-12(9-13)15-14(23)16(17(22)26-15)27-28(24,25)10-11-5-2-1-3-6-11/h1-9,15H,10,22H2/i15D |
| InChIKey | PLRFYKHCOKBGPL-RWFJLFJASA-N |
| XLogP | 3.02 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|