C24H33ClN4S2 — CID 175998745
(6R)-6-N-[[1-(1-benzothiophen-4-yl)piperidin-4-yl]methyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride (PubChem CID 175998745) has the molecular formula C24H33ClN4S2 and a molecular weight of 477.14 g/mol. Its IUPAC name is (6R)-6-N-[[1-(1-benzothiophen-4-yl)piperidin-4-yl]methyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride.
| Compound Name | (6R)-6-N-[[1-(1-benzothiophen-4-yl)piperidin-4-yl]methyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 175998745 |
| Molecular Formula | C24H33ClN4S2 |
| Molecular Weight | 477.14 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | (6R)-6-N-[[1-(1-benzothiophen-4-yl)piperidin-4-yl]methyl]-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride |
| SMILES | CCCN(CC1CCN(c2cccc3sccc23)CC1)[C@@H]1CCc2nc(N)sc2C1.Cl |
| InChI | InChI=1S/C24H32N4S2.ClH/c1-2-11-28(18-6-7-20-23(15-18)30-24(25)26-20)16-17-8-12-27(13-9-17)21-4-3-5-22-19(21)10-14-29-22;/h3-5,10,14,17-18H,2,6-9,11-13,15-16H2,1H3,(H2,25,26);1H/t18-;/m1./s1 |
| InChIKey | COMHWNNDVZGSEE-GMUIIQOCSA-N |
| XLogP | 5.85 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.14 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |