About bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+)
bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) (PubChem CID 175999489) has the molecular formula C24H28HfSi
and a molecular weight of 523.06 g/mol. Its IUPAC name is bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+).
Molecular Properties
| Compound Name | bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) |
| PubChem CID | 175999489 |
| Molecular Formula | C24H28HfSi |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) |
| SMILES | C[Si](C)=[Hf+2].Cc1ccc(C)c2[cH-]ccc12.Cc1ccc(C)c2[cH-]ccc12 |
| InChI | InChI=1S/2C11H11.C2H6Si.Hf/c2*1-8-6-7-9(2)11-5-3-4-10(8)11;1-3-2;/h2*3-7H,1-2H3;1-2H3;/q2*-1;;+2 |
| InChIKey | XWGNBOAGMKDFPG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+)?
The IUPAC name of bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) (CID 175999489) is bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+).
What is the SMILES notation for bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+)?
The canonical SMILES for bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) is C[Si](C)=[Hf+2].Cc1ccc(C)c2[cH-]ccc12.Cc1ccc(C)c2[cH-]ccc12.
What is the InChIKey of bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+)?
The InChIKey is XWGNBOAGMKDFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H11.C2H6Si.Hf/c2*1-8-6-7-9(2)11-5-3-4-10(8)11;1-3-2;/h2*3-7H,1-2H3;1-2H3;/q2*-1;;+2.
What are the key properties of bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+)?
bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) has a molecular weight of 523.06 g/mol, XLogP of 7.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,7-dimethyl-1H-inden-1-ide);dimethylsilylidenehafnium(2+) is sourced from PubChem (CID 175999489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).