About methyl 2-acetamidobenzoate
methyl 2-acetamidobenzoate (PubChem CID 17623) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl 2-acetamidobenzoate.
Molecular Properties
| Compound Name | methyl 2-acetamidobenzoate |
| PubChem CID | 17623 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl 2-acetamidobenzoate |
| SMILES | COC(=O)c1ccccc1NC(C)=O |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
| InChIKey | UYQKZKVNYKOXHG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamidobenzoate?
The IUPAC name of methyl 2-acetamidobenzoate (CID 17623) is methyl 2-acetamidobenzoate.
What is the SMILES notation for methyl 2-acetamidobenzoate?
The canonical SMILES for methyl 2-acetamidobenzoate is COC(=O)c1ccccc1NC(C)=O.
What is the InChIKey of methyl 2-acetamidobenzoate?
The InChIKey is UYQKZKVNYKOXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12).
What are the key properties of methyl 2-acetamidobenzoate?
methyl 2-acetamidobenzoate has a molecular weight of 193.20 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamidobenzoate is sourced from PubChem (CID 17623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).