About dodecan-4-ylbenzene
dodecan-4-ylbenzene (PubChem CID 17631) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is dodecan-4-ylbenzene.
Molecular Properties
| Compound Name | dodecan-4-ylbenzene |
| PubChem CID | 17631 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | dodecan-4-ylbenzene |
| SMILES | CCCCCCCCC(CCC)c1ccccc1 |
| InChI | InChI=1S/C18H30/c1-3-5-6-7-8-10-14-17(13-4-2)18-15-11-9-12-16-18/h9,11-12,15-17H,3-8,10,13-14H2,1-2H3 |
| InChIKey | RHDHXBLZBVAPTL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-4-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-4-ylbenzene?
The IUPAC name of dodecan-4-ylbenzene (CID 17631) is dodecan-4-ylbenzene.
What is the SMILES notation for dodecan-4-ylbenzene?
The canonical SMILES for dodecan-4-ylbenzene is CCCCCCCCC(CCC)c1ccccc1.
What is the InChIKey of dodecan-4-ylbenzene?
The InChIKey is RHDHXBLZBVAPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-3-5-6-7-8-10-14-17(13-4-2)18-15-11-9-12-16-18/h9,11-12,15-17H,3-8,10,13-14H2,1-2H3.
What are the key properties of dodecan-4-ylbenzene?
dodecan-4-ylbenzene has a molecular weight of 246.44 g/mol, XLogP of 6.32, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-4-ylbenzene is sourced from PubChem (CID 17631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).