C19H18F3NO2 — CID 176435950
ethyl (E)-3-[4-(benzylamino)-3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 176435950) has the molecular formula C19H18F3NO2 and a molecular weight of 349.30 g/mol. Its IUPAC name is ethyl (E)-3-[4-(benzylamino)-3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(benzylamino)-3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 176435950 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl (E)-3-[4-(benzylamino)-3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C=C1)NCC2=CC=CC=C2)C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO2/c1-2-25-18(24)11-9-14-8-10-17(16(12-14)19(20,21)22)23-13-15-6-4-3-5-7-15/h3-12,23H,2,13H2,1H3/b11-9+ |
| InChIKey | NYIWGPMOLXBWBS-PKNBQFBNSA-N |
| XLogP | 4.90 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | 444 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|