C22H27N3O3 — CID 176500068
N-ethyl-3-oxo-2-(2-phenylethyl)-7-propanoyl-6,8-dihydro-5H-2,7-naphthyridine-4-carboxamide (PubChem CID 176500068) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-ethyl-3-oxo-2-(2-phenylethyl)-7-propanoyl-6,8-dihydro-5H-2,7-naphthyridine-4-carboxamide.
| Compound Name | N-ethyl-3-oxo-2-(2-phenylethyl)-7-propanoyl-6,8-dihydro-5H-2,7-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 176500068 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-ethyl-3-oxo-2-(2-phenylethyl)-7-propanoyl-6,8-dihydro-5H-2,7-naphthyridine-4-carboxamide |
| SMILES | CCNC(=O)c1c2c(cn(CCc3ccccc3)c1=O)CN(C(=O)CC)CC2 |
| InChI | InChI=1S/C22H27N3O3/c1-3-19(26)24-13-11-18-17(14-24)15-25(12-10-16-8-6-5-7-9-16)22(28)20(18)21(27)23-4-2/h5-9,15H,3-4,10-14H2,1-2H3,(H,23,27) |
| InChIKey | KMUZXTMTKRQUCS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|