C26H34N2O3 — CID 176500218
1-[4-(3,3-dimethylbut-1-ynyl)naphthalen-2-yl]oxy-3-[4-(oxetan-3-yl)piperazin-1-yl]propan-2-ol (PubChem CID 176500218) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylbut-1-ynyl)naphthalen-2-yl]oxy-3-[4-(oxetan-3-yl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[4-(3,3-dimethylbut-1-ynyl)naphthalen-2-yl]oxy-3-[4-(oxetan-3-yl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 176500218 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 1-[4-(3,3-dimethylbut-1-ynyl)naphthalen-2-yl]oxy-3-[4-(oxetan-3-yl)piperazin-1-yl]propan-2-ol |
| SMILES | CC(C)(C)C#Cc1cc(OCC(O)CN2CCN(C3COC3)CC2)cc2ccccc12 |
| InChI | InChI=1S/C26H34N2O3/c1-26(2,3)9-8-21-15-24(14-20-6-4-5-7-25(20)21)31-19-23(29)16-27-10-12-28(13-11-27)22-17-30-18-22/h4-7,14-15,22-23,29H,10-13,16-19H2,1-3H3 |
| InChIKey | BYTAZCLIFGSXGN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|