C20H28N6O3 — CID 176500717
(3aS,5R,6R,7aR)-5-(4-cyclopropyltriazol-1-yl)-2-(2,6-dimethoxypyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 176500717) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-5-(4-cyclopropyltriazol-1-yl)-2-(2,6-dimethoxypyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5R,6R,7aR)-5-(4-cyclopropyltriazol-1-yl)-2-(2,6-dimethoxypyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 176500717 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (3aS,5R,6R,7aR)-5-(4-cyclopropyltriazol-1-yl)-2-(2,6-dimethoxypyrimidin-4-yl)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | COc1cc(N2C[C@H]3C[C@@H](n4cc(C5CC5)nn4)[C@H](OC)C[C@H]3C2)nc(OC)n1 |
| InChI | InChI=1S/C20H28N6O3/c1-27-17-7-14-10-25(18-8-19(28-2)22-20(21-18)29-3)9-13(14)6-16(17)26-11-15(23-24-26)12-4-5-12/h8,11-14,16-17H,4-7,9-10H2,1-3H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | PVXRPRCTVVUFQM-YALNPMBYSA-N |
| XLogP | 2.07 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |