About N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide
N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide (PubChem CID 176501109) has the molecular formula C22H22N4O4
and a molecular weight of 406.44 g/mol. Its IUPAC name is N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide.
Molecular Properties
| Compound Name | N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide |
| PubChem CID | 176501109 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide |
| SMILES | COc1cc(C(=O)NC2CC2)cc(NC(=O)c2ccccc2-n2cccn2)c1OC |
| InChI | InChI=1S/C22H22N4O4/c1-29-19-13-14(21(27)24-15-8-9-15)12-17(20(19)30-2)25-22(28)16-6-3-4-7-18(16)26-11-5-10-23-26/h3-7,10-13,15H,8-9H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | XBZBLGFGVFPPRB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide?
The IUPAC name of N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide (CID 176501109) is N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide.
What is the SMILES notation for N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide?
The canonical SMILES for N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide is COc1cc(C(=O)NC2CC2)cc(NC(=O)c2ccccc2-n2cccn2)c1OC.
What is the InChIKey of N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide?
The InChIKey is XBZBLGFGVFPPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O4/c1-29-19-13-14(21(27)24-15-8-9-15)12-17(20(19)30-2)25-22(28)16-6-3-4-7-18(16)26-11-5-10-23-26/h3-7,10-13,15H,8-9H2,1-2H3,(H,24,27)(H,25,28).
What are the key properties of N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide?
N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide has a molecular weight of 406.44 g/mol, XLogP of 3.03, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3,4-dimethoxy-5-[(2-pyrazol-1-ylbenzoyl)amino]benzamide is sourced from PubChem (CID 176501109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).