C20H20N4O4 — CID 176502571
N-[(3R,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-phenylimidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 176502571) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-phenylimidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-[(3R,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-phenylimidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 176502571 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(3R,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-phenylimidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2NC(=O)c1cnc2c(c1)ncn2-c1ccccc1 |
| InChI | InChI=1S/C20H20N4O4/c1-26-16-10-28-17-15(9-27-18(16)17)23-20(25)12-7-14-19(21-8-12)24(11-22-14)13-5-3-2-4-6-13/h2-8,11,15-18H,9-10H2,1H3,(H,23,25)/t15-,16-,17-,18-/m1/s1 |
| InChIKey | HWJNHFBSDBDZBY-BRSBDYLESA-N |
| XLogP | 1.33 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |