C18H23N3O3S — CID 176503072
N,N-dimethyl-6-oxo-7-(2-phenylethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-sulfonamide (PubChem CID 176503072) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N,N-dimethyl-6-oxo-7-(2-phenylethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-sulfonamide.
| Compound Name | N,N-dimethyl-6-oxo-7-(2-phenylethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-sulfonamide |
|---|---|
| PubChem CID | 176503072 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N,N-dimethyl-6-oxo-7-(2-phenylethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2cc(=O)n(CCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C18H23N3O3S/c1-19(2)25(23,24)21-11-9-16-12-18(22)20(13-17(16)14-21)10-8-15-6-4-3-5-7-15/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | STIOSLHKUMNBRG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|