C16H24N6O — CID 176503237
4-[4-(6-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)piperazin-1-yl]butan-1-ol (PubChem CID 176503237) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-[4-(6-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)piperazin-1-yl]butan-1-ol.
| Compound Name | 4-[4-(6-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 176503237 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-[4-(6-cyclopropyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)piperazin-1-yl]butan-1-ol |
| SMILES | OCCCCN1CCN(c2cc(C3CC3)nn3cnnc23)CC1 |
| InChI | InChI=1S/C16H24N6O/c23-10-2-1-5-20-6-8-21(9-7-20)15-11-14(13-3-4-13)19-22-12-17-18-16(15)22/h11-13,23H,1-10H2 |
| InChIKey | YATGMGBOSCNXKF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|