C25H21FN2O2 — CID 176503487
[5-(7-fluoroquinolin-3-yl)naphthalen-1-yl]-(3-methoxypyrrolidin-1-yl)methanone (PubChem CID 176503487) has the molecular formula C25H21FN2O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is [5-(7-fluoroquinolin-3-yl)naphthalen-1-yl]-(3-methoxypyrrolidin-1-yl)methanone.
| Compound Name | [5-(7-fluoroquinolin-3-yl)naphthalen-1-yl]-(3-methoxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 176503487 |
| Molecular Formula | C25H21FN2O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [5-(7-fluoroquinolin-3-yl)naphthalen-1-yl]-(3-methoxypyrrolidin-1-yl)methanone |
| SMILES | COC1CCN(C(=O)c2cccc3c(-c4cnc5cc(F)ccc5c4)cccc23)C1 |
| InChI | InChI=1S/C25H21FN2O2/c1-30-19-10-11-28(15-19)25(29)23-7-3-5-21-20(4-2-6-22(21)23)17-12-16-8-9-18(26)13-24(16)27-14-17/h2-9,12-14,19H,10-11,15H2,1H3 |
| InChIKey | CTMHHKRRLJKFOS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |