C18H27N7O — CID 176503652
1'-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)-N,N-dimethylspiro[5,6-dihydropyrano[3,4-d]pyrimidine-8,4'-piperidine]-2-amine (PubChem CID 176503652) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1'-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)-N,N-dimethylspiro[5,6-dihydropyrano[3,4-d]pyrimidine-8,4'-piperidine]-2-amine.
| Compound Name | 1'-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)-N,N-dimethylspiro[5,6-dihydropyrano[3,4-d]pyrimidine-8,4'-piperidine]-2-amine |
|---|---|
| PubChem CID | 176503652 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1'-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)-N,N-dimethylspiro[5,6-dihydropyrano[3,4-d]pyrimidine-8,4'-piperidine]-2-amine |
| SMILES | CCc1nc(N2CCC3(CC2)OCCc2cnc(N(C)C)nc23)n(C)n1 |
| InChI | InChI=1S/C18H27N7O/c1-5-14-20-17(24(4)22-14)25-9-7-18(8-10-25)15-13(6-11-26-18)12-19-16(21-15)23(2)3/h12H,5-11H2,1-4H3 |
| InChIKey | DPWAGPWADCNGBZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |