C24H29N5O2 — CID 176503776
[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-6-yl]methanone (PubChem CID 176503776) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-6-yl]methanone.
| Compound Name | [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 176503776 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[3-(2-methylpropyl)imidazo[4,5-b]pyridin-6-yl]methanone |
| SMILES | CC(C)Cn1cnc2cc(C(=O)N3CCN4[C@@H](COC[C@@H]4c4ccccc4)C3)cnc21 |
| InChI | InChI=1S/C24H29N5O2/c1-17(2)12-28-16-26-21-10-19(11-25-23(21)28)24(30)27-8-9-29-20(13-27)14-31-15-22(29)18-6-4-3-5-7-18/h3-7,10-11,16-17,20,22H,8-9,12-15H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | IJIVNOARWBHKQL-IFMALSPDSA-N |
| XLogP | 2.99 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |