About (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone
(3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone (PubChem CID 176503873) has the molecular formula C23H26N4O2
and a molecular weight of 390.49 g/mol. Its IUPAC name is (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone |
| PubChem CID | 176503873 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cnc2c(c1)ncn2C1CCCC1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O2/c28-22(26-12-10-23(29,11-13-26)18-6-2-1-3-7-18)17-14-20-21(24-15-17)27(16-25-20)19-8-4-5-9-19/h1-3,6-7,14-16,19,29H,4-5,8-13H2 |
| InChIKey | XFACDWSRYONNQA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
The IUPAC name of (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone (CID 176503873) is (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone.
What is the SMILES notation for (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
The canonical SMILES for (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone is O=C(c1cnc2c(c1)ncn2C1CCCC1)N1CCC(O)(c2ccccc2)CC1.
What is the InChIKey of (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
The InChIKey is XFACDWSRYONNQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O2/c28-22(26-12-10-23(29,11-13-26)18-6-2-1-3-7-18)17-14-20-21(24-15-17)27(16-25-20)19-8-4-5-9-19/h1-3,6-7,14-16,19,29H,4-5,8-13H2.
What are the key properties of (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone?
(3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone has a molecular weight of 390.49 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopentylimidazo[4,5-b]pyridin-6-yl)-(4-hydroxy-4-phenylpiperidin-1-yl)methanone is sourced from PubChem (CID 176503873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).