C19H19N3O3 — CID 176504288
7-(5-methoxy-1H-indole-2-carbonyl)-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one (PubChem CID 176504288) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 7-(5-methoxy-1H-indole-2-carbonyl)-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one.
| Compound Name | 7-(5-methoxy-1H-indole-2-carbonyl)-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one |
|---|---|
| PubChem CID | 176504288 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 7-(5-methoxy-1H-indole-2-carbonyl)-2-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-one |
| SMILES | COc1ccc2[nH]c(C(=O)N3CCc4cc(=O)n(C)cc4C3)cc2c1 |
| InChI | InChI=1S/C19H19N3O3/c1-21-10-14-11-22(6-5-12(14)9-18(21)23)19(24)17-8-13-7-15(25-2)3-4-16(13)20-17/h3-4,7-10,20H,5-6,11H2,1-2H3 |
| InChIKey | TUPJKERGUXHHMQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|