C21H35N5O3 — CID 176504541
1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(diethylaminomethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-hydroxyethanone (PubChem CID 176504541) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(diethylaminomethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(diethylaminomethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 176504541 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(diethylaminomethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-hydroxyethanone |
| SMILES | CCN(CC)Cc1cn([C@@H]2C[C@@H]3CN(C(=O)CO)C[C@@H]3C[C@H]2OCC2CC2)nn1 |
| InChI | InChI=1S/C21H35N5O3/c1-3-24(4-2)11-18-12-26(23-22-18)19-7-16-9-25(21(28)13-27)10-17(16)8-20(19)29-14-15-5-6-15/h12,15-17,19-20,27H,3-11,13-14H2,1-2H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | NRUGRGLEADXBKY-PIKOESSRSA-N |
| XLogP | 1.32 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |