C23H31FN4O3 — CID 176504898
(3aR,5R,6R,7aS)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)-6-[2-fluoro-3-(pyrrolidin-1-ylmethyl)phenoxy]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 176504898) has the molecular formula C23H31FN4O3 and a molecular weight of 430.52 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)-6-[2-fluoro-3-(pyrrolidin-1-ylmethyl)phenoxy]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)-6-[2-fluoro-3-(pyrrolidin-1-ylmethyl)phenoxy]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 176504898 |
| Molecular Formula | C23H31FN4O3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-(5-ethyl-1,2,4-oxadiazol-3-yl)-6-[2-fluoro-3-(pyrrolidin-1-ylmethyl)phenoxy]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CCc1nc(N2C[C@H]3C[C@@H](Oc4cccc(CN5CCCC5)c4F)[C@H](O)C[C@H]3C2)no1 |
| InChI | InChI=1S/C23H31FN4O3/c1-2-21-25-23(26-31-21)28-13-16-10-18(29)20(11-17(16)14-28)30-19-7-5-6-15(22(19)24)12-27-8-3-4-9-27/h5-7,16-18,20,29H,2-4,8-14H2,1H3/t16-,17+,18+,20+/m0/s1 |
| InChIKey | ZATJSZUGUMHCDP-JRBPQWBISA-N |
| XLogP | 3.02 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |