C21H25N5O — CID 176505475
N-(azepan-4-yl)-3-(2-phenylethyl)imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 176505475) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is N-(azepan-4-yl)-3-(2-phenylethyl)imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-(azepan-4-yl)-3-(2-phenylethyl)imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 176505475 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-(azepan-4-yl)-3-(2-phenylethyl)imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | O=C(NC1CCCNCC1)c1cnc2c(c1)ncn2CCc1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c27-21(25-18-7-4-10-22-11-8-18)17-13-19-20(23-14-17)26(15-24-19)12-9-16-5-2-1-3-6-16/h1-3,5-6,13-15,18,22H,4,7-12H2,(H,25,27) |
| InChIKey | BZAWIRGZPNJSTO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |