C23H31F2N5O2 — CID 176505963
(3aR,5R,6R,7aS)-6-[3,5-difluoro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 176505963) has the molecular formula C23H31F2N5O2 and a molecular weight of 447.53 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-[3,5-difluoro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-[3,5-difluoro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 176505963 |
| Molecular Formula | C23H31F2N5O2 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-[3,5-difluoro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | Cn1cnnc1CN1C[C@H]2C[C@@H](Oc3cc(F)c(CN4CCCC4)c(F)c3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C23H31F2N5O2/c1-28-14-26-27-23(28)13-30-10-15-6-21(31)22(7-16(15)11-30)32-17-8-19(24)18(20(25)9-17)12-29-4-2-3-5-29/h8-9,14-16,21-22,31H,2-7,10-13H2,1H3/t15-,16+,21+,22+/m0/s1 |
| InChIKey | AHRVYDNQBAZUCR-LGFFLQIISA-N |
| XLogP | 2.34 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |