C17H21N7OS — CID 176506847
3-cyclopentyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 176506847) has the molecular formula C17H21N7OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-cyclopentyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 3-cyclopentyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 176506847 |
| Molecular Formula | C17H21N7OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-cyclopentyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | Cn1cnnc1SCCNC(=O)c1cnc2c(c1)ncn2C1CCCC1 |
| InChI | InChI=1S/C17H21N7OS/c1-23-11-21-22-17(23)26-7-6-18-16(25)12-8-14-15(19-9-12)24(10-20-14)13-4-2-3-5-13/h8-11,13H,2-7H2,1H3,(H,18,25) |
| InChIKey | PDSXHHJBEHFQBU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|