C18H26N2O3S — CID 176506994
(3aR,7aS)-5-(4-tert-butylphenyl)sulfonyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 176506994) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is (3aR,7aS)-5-(4-tert-butylphenyl)sulfonyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-5-(4-tert-butylphenyl)sulfonyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 176506994 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3aR,7aS)-5-(4-tert-butylphenyl)sulfonyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | CN1C(=O)C[C@@H]2CN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC[C@@H]21 |
| InChI | InChI=1S/C18H26N2O3S/c1-18(2,3)14-5-7-15(8-6-14)24(22,23)20-10-9-16-13(12-20)11-17(21)19(16)4/h5-8,13,16H,9-12H2,1-4H3/t13-,16+/m1/s1 |
| InChIKey | YJGFCCFCWDMHBT-CJNGLKHVSA-N |
| XLogP | 2.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |