C13H11N3O4 — CID 176507312
15-amino-9-hydroxy-4,12-dioxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),6,9,14-pentaen-5-one (PubChem CID 176507312) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 15-amino-9-hydroxy-4,12-dioxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),6,9,14-pentaen-5-one.
| Compound Name | 15-amino-9-hydroxy-4,12-dioxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),6,9,14-pentaen-5-one |
|---|---|
| PubChem CID | 176507312 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 15-amino-9-hydroxy-4,12-dioxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),6,9,14-pentaen-5-one |
| SMILES | NC1=NC2CC(N1)c1c(cc(O)c3ccc(=O)oc13)O2 |
| InChI | InChI=1S/C13H11N3O4/c14-13-15-6-3-9(16-13)19-8-4-7(17)5-1-2-10(18)20-12(5)11(6)8/h1-2,4,6,9,17H,3H2,(H3,14,15,16) |
| InChIKey | SWBMJQPGSVLCHB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|