About Nitrazepam sodium
Nitrazepam sodium (PubChem CID 176507617) has the molecular formula C15H11N3NaO3
and a molecular weight of 304.26 g/mol.
Molecular Properties
| Compound Name | Nitrazepam sodium |
| PubChem CID | 176507617 |
| Molecular Formula | C15H11N3NaO3 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | — |
| SMILES | O=C1CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc2N1.[Na] |
| InChI | InChI=1S/C15H11N3O3.Na/c19-14-9-16-15(10-4-2-1-3-5-10)12-8-11(18(20)21)6-7-13(12)17-14;/h1-8H,9H2,(H,17,19); |
| InChIKey | VMGKGSUVFPYBEB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Nitrazepam sodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nitrazepam sodium?
The IUPAC name of Nitrazepam sodium (CID 176507617) is not available.
What is the SMILES notation for Nitrazepam sodium?
The canonical SMILES for Nitrazepam sodium is O=C1CN=C(c2ccccc2)c2cc([N+](=O)[O-])ccc2N1.[Na].
What is the InChIKey of Nitrazepam sodium?
The InChIKey is VMGKGSUVFPYBEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O3.Na/c19-14-9-16-15(10-4-2-1-3-5-10)12-8-11(18(20)21)6-7-13(12)17-14;/h1-8H,9H2,(H,17,19);.
What are the key properties of Nitrazepam sodium?
Nitrazepam sodium has a molecular weight of 304.26 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Nitrazepam sodium is sourced from PubChem (CID 176507617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).