About CID 176507812
CID 176507812 (PubChem CID 176507812) has the molecular formula C32H52FeP2
and a molecular weight of 554.56 g/mol.
Molecular Properties
| Compound Name | CID 176507812 |
| PubChem CID | 176507812 |
| Molecular Formula | C32H52FeP2 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | — |
| SMILES | C[C@H](C1[C]=CC=C1P(C1CCCCC1)C1CCCCC1)P(C(C)(C)C)C(C)(C)C.[C]1=CC=CC1.[Fe] |
| InChI | InChI=1S/C27H47P2.C5H5.Fe/c1-21(29(26(2,3)4)27(5,6)7)24-19-14-20-25(24)28(22-15-10-8-11-16-22)23-17-12-9-13-18-23;1-2-4-5-3-1;/h14,20-24H,8-13,15-18H2,1-7H3;1-3H,4H2;/t21-,24?;;/m1../s1 |
| InChIKey | IYEYYQWJFLXTPS-AMPUPPTDSA-N |
| XLogP | 10.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 176507812 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176507812?
The IUPAC name of CID 176507812 (CID 176507812) is not available.
What is the SMILES notation for CID 176507812?
The canonical SMILES for CID 176507812 is C[C@H](C1[C]=CC=C1P(C1CCCCC1)C1CCCCC1)P(C(C)(C)C)C(C)(C)C.[C]1=CC=CC1.[Fe].
What is the InChIKey of CID 176507812?
The InChIKey is IYEYYQWJFLXTPS-AMPUPPTDSA-N. The full InChI is InChI=1S/C27H47P2.C5H5.Fe/c1-21(29(26(2,3)4)27(5,6)7)24-19-14-20-25(24)28(22-15-10-8-11-16-22)23-17-12-9-13-18-23;1-2-4-5-3-1;/h14,20-24H,8-13,15-18H2,1-7H3;1-3H,4H2;/t21-,24?;;/m1../s1.
What are the key properties of CID 176507812?
CID 176507812 has a molecular weight of 554.56 g/mol, XLogP of 10.78, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176507812 is sourced from PubChem (CID 176507812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).