C16H22FIN2O2 — CID 176507965
tert-butyl N-[1-[(4-fluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]carbamate (PubChem CID 176507965) has the molecular formula C16H22FIN2O2 and a molecular weight of 420.27 g/mol. Its IUPAC name is tert-butyl N-[1-[(4-fluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4-fluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 176507965 |
| Molecular Formula | C16H22FIN2O2 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | tert-butyl N-[1-[(4-fluoro-3-iodophenyl)methyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(Cc2ccc(F)c(I)c2)C1 |
| InChI | InChI=1S/C16H22FIN2O2/c1-16(2,3)22-15(21)19-12-6-7-20(10-12)9-11-4-5-13(17)14(18)8-11/h4-5,8,12H,6-7,9-10H2,1-3H3,(H,19,21) |
| InChIKey | WMXRVNHQYINCEP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|